C19H24N8O3 — CID 136641378
N'-[2-(5-ethyl-4-methyl-6-oxo-1H-pyrimidin-2-yl)-5-methylpyrazol-3-yl]-N-(3-imidazol-1-ylpropyl)oxamide (PubChem CID 136641378) has the molecular formula C19H24N8O3 and a molecular weight of 412.45 g/mol. Its IUPAC name is N'-[2-(5-ethyl-4-methyl-6-oxo-1H-pyrimidin-2-yl)-5-methylpyrazol-3-yl]-N-(3-imidazol-1-ylpropyl)oxamide.
| Compound Name | N'-[2-(5-ethyl-4-methyl-6-oxo-1H-pyrimidin-2-yl)-5-methylpyrazol-3-yl]-N-(3-imidazol-1-ylpropyl)oxamide |
|---|---|
| PubChem CID | 136641378 |
| Molecular Formula | C19H24N8O3 |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | N'-[2-(5-ethyl-4-methyl-6-oxo-1H-pyrimidin-2-yl)-5-methylpyrazol-3-yl]-N-(3-imidazol-1-ylpropyl)oxamide |
| SMILES | CCc1c(C)nc(-n2nc(C)cc2NC(=O)C(=O)NCCCn2ccnc2)[nH]c1=O |
| InChI | InChI=1S/C19H24N8O3/c1-4-14-13(3)22-19(24-16(14)28)27-15(10-12(2)25-27)23-18(30)17(29)21-6-5-8-26-9-7-20-11-26/h7,9-11H,4-6,8H2,1-3H3,(H,21,29)(H,23,30)(H,22,24,28) |
| InChIKey | AACLILAHDVPRHU-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 139.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|