C14H19N5O3 — CID 135551754
ethyl N-[2-(5-ethyl-4-methyl-6-oxo-1H-pyrimidin-2-yl)-5-methylpyrazol-3-yl]carbamate (PubChem CID 135551754) has the molecular formula C14H19N5O3 and a molecular weight of 305.34 g/mol. Its IUPAC name is ethyl N-[2-(5-ethyl-4-methyl-6-oxo-1H-pyrimidin-2-yl)-5-methylpyrazol-3-yl]carbamate.
| Compound Name | ethyl N-[2-(5-ethyl-4-methyl-6-oxo-1H-pyrimidin-2-yl)-5-methylpyrazol-3-yl]carbamate |
|---|---|
| PubChem CID | 135551754 |
| Molecular Formula | C14H19N5O3 |
| Molecular Weight | 305.34 g/mol |
| Exact Mass | 305.15 |
| IUPAC Name | ethyl N-[2-(5-ethyl-4-methyl-6-oxo-1H-pyrimidin-2-yl)-5-methylpyrazol-3-yl]carbamate |
| SMILES | CCOC(=O)Nc1cc(C)nn1-c1nc(C)c(CC)c(=O)[nH]1 |
| InChI | InChI=1S/C14H19N5O3/c1-5-10-9(4)15-13(17-12(10)20)19-11(7-8(3)18-19)16-14(21)22-6-2/h7H,5-6H2,1-4H3,(H,16,21)(H,15,17,20) |
| InChIKey | CXNRONJVSSBXQP-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.34 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |