C20H22N6O6 — CID 136636519
N-[2-(5-ethyl-4-methyl-6-oxo-1H-pyrimidin-2-yl)-5-methylpyrazol-3-yl]-4,5-dimethoxy-2-nitrobenzamide (PubChem CID 136636519) has the molecular formula C20H22N6O6 and a molecular weight of 442.43 g/mol. Its IUPAC name is N-[2-(5-ethyl-4-methyl-6-oxo-1H-pyrimidin-2-yl)-5-methylpyrazol-3-yl]-4,5-dimethoxy-2-nitrobenzamide.
| Compound Name | N-[2-(5-ethyl-4-methyl-6-oxo-1H-pyrimidin-2-yl)-5-methylpyrazol-3-yl]-4,5-dimethoxy-2-nitrobenzamide |
|---|---|
| PubChem CID | 136636519 |
| Molecular Formula | C20H22N6O6 |
| Molecular Weight | 442.43 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | N-[2-(5-ethyl-4-methyl-6-oxo-1H-pyrimidin-2-yl)-5-methylpyrazol-3-yl]-4,5-dimethoxy-2-nitrobenzamide |
| SMILES | CCc1c(C)nc(-n2nc(C)cc2NC(=O)c2cc(OC)c(OC)cc2[N+](=O)[O-])[nH]c1=O |
| InChI | InChI=1S/C20H22N6O6/c1-6-12-11(3)21-20(23-18(12)27)25-17(7-10(2)24-25)22-19(28)13-8-15(31-4)16(32-5)9-14(13)26(29)30/h7-9H,6H2,1-5H3,(H,22,28)(H,21,23,27) |
| InChIKey | BIPAUPGGIPMCGJ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 154.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.43 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|