C21H18ClF3N4O5 — CID 55519908
N-[2-[2-chloro-5-(trifluoromethyl)phenyl]-5-methylpyrazol-3-yl]-5-ethoxy-4-methoxy-2-nitrobenzamide (PubChem CID 55519908) has the molecular formula C21H18ClF3N4O5 and a molecular weight of 498.85 g/mol. Its IUPAC name is N-[2-[2-chloro-5-(trifluoromethyl)phenyl]-5-methylpyrazol-3-yl]-5-ethoxy-4-methoxy-2-nitrobenzamide.
| Compound Name | N-[2-[2-chloro-5-(trifluoromethyl)phenyl]-5-methylpyrazol-3-yl]-5-ethoxy-4-methoxy-2-nitrobenzamide |
|---|---|
| PubChem CID | 55519908 |
| Molecular Formula | C21H18ClF3N4O5 |
| Molecular Weight | 498.85 g/mol |
| Exact Mass | 498.09 |
| IUPAC Name | N-[2-[2-chloro-5-(trifluoromethyl)phenyl]-5-methylpyrazol-3-yl]-5-ethoxy-4-methoxy-2-nitrobenzamide |
| SMILES | CCOc1cc(C(=O)Nc2cc(C)nn2-c2cc(C(F)(F)F)ccc2Cl)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C21H18ClF3N4O5/c1-4-34-18-9-13(15(29(31)32)10-17(18)33-3)20(30)26-19-7-11(2)27-28(19)16-8-12(21(23,24)25)5-6-14(16)22/h5-10H,4H2,1-3H3,(H,26,30) |
| InChIKey | LMEQXFJIWOUGDD-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 108.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.85 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|