C16H12ClF3N6O3 — CID 112814363
N-[2-[2-chloro-5-(trifluoromethyl)phenyl]-5-methylpyrazol-3-yl]-2-(4-nitropyrazol-1-yl)acetamide (PubChem CID 112814363) has the molecular formula C16H12ClF3N6O3 and a molecular weight of 428.76 g/mol. Its IUPAC name is N-[2-[2-chloro-5-(trifluoromethyl)phenyl]-5-methylpyrazol-3-yl]-2-(4-nitropyrazol-1-yl)acetamide.
| Compound Name | N-[2-[2-chloro-5-(trifluoromethyl)phenyl]-5-methylpyrazol-3-yl]-2-(4-nitropyrazol-1-yl)acetamide |
|---|---|
| PubChem CID | 112814363 |
| Molecular Formula | C16H12ClF3N6O3 |
| Molecular Weight | 428.76 g/mol |
| Exact Mass | 428.06 |
| IUPAC Name | N-[2-[2-chloro-5-(trifluoromethyl)phenyl]-5-methylpyrazol-3-yl]-2-(4-nitropyrazol-1-yl)acetamide |
| SMILES | Cc1cc(NC(=O)Cn2cc([N+](=O)[O-])cn2)n(-c2cc(C(F)(F)F)ccc2Cl)n1 |
| InChI | InChI=1S/C16H12ClF3N6O3/c1-9-4-14(22-15(27)8-24-7-11(6-21-24)26(28)29)25(23-9)13-5-10(16(18,19)20)2-3-12(13)17/h2-7H,8H2,1H3,(H,22,27) |
| InChIKey | BWTCFQSDOUDTIK-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 107.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.76 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|