C19H15F3N4O3 — CID 55507980
N-[5-methyl-2-(4-nitrophenyl)pyrazol-3-yl]-2-[3-(trifluoromethyl)phenyl]acetamide (PubChem CID 55507980) has the molecular formula C19H15F3N4O3 and a molecular weight of 404.35 g/mol. Its IUPAC name is N-[5-methyl-2-(4-nitrophenyl)pyrazol-3-yl]-2-[3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | N-[5-methyl-2-(4-nitrophenyl)pyrazol-3-yl]-2-[3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 55507980 |
| Molecular Formula | C19H15F3N4O3 |
| Molecular Weight | 404.35 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | N-[5-methyl-2-(4-nitrophenyl)pyrazol-3-yl]-2-[3-(trifluoromethyl)phenyl]acetamide |
| SMILES | Cc1cc(NC(=O)Cc2cccc(C(F)(F)F)c2)n(-c2ccc([N+](=O)[O-])cc2)n1 |
| InChI | InChI=1S/C19H15F3N4O3/c1-12-9-17(25(24-12)15-5-7-16(8-6-15)26(28)29)23-18(27)11-13-3-2-4-14(10-13)19(20,21)22/h2-10H,11H2,1H3,(H,23,27) |
| InChIKey | ZMKPISYRZVLWOY-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 90.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.35 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|