C19H18N4O3 — CID 55519581
N-[5-methyl-2-(4-nitrophenyl)pyrazol-3-yl]-2-(2-methylphenyl)acetamide (PubChem CID 55519581) has the molecular formula C19H18N4O3 and a molecular weight of 350.38 g/mol. Its IUPAC name is N-[5-methyl-2-(4-nitrophenyl)pyrazol-3-yl]-2-(2-methylphenyl)acetamide.
| Compound Name | N-[5-methyl-2-(4-nitrophenyl)pyrazol-3-yl]-2-(2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 55519581 |
| Molecular Formula | C19H18N4O3 |
| Molecular Weight | 350.38 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | N-[5-methyl-2-(4-nitrophenyl)pyrazol-3-yl]-2-(2-methylphenyl)acetamide |
| SMILES | Cc1cc(NC(=O)Cc2ccccc2C)n(-c2ccc([N+](=O)[O-])cc2)n1 |
| InChI | InChI=1S/C19H18N4O3/c1-13-5-3-4-6-15(13)12-19(24)20-18-11-14(2)21-22(18)16-7-9-17(10-8-16)23(25)26/h3-11H,12H2,1-2H3,(H,20,24) |
| InChIKey | HQOBMQFQAGZGKS-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 90.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.38 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|