C21H18N6O7 — CID 136606222
N-[3-(furan-2-yl)-1-(4-methyl-6-oxo-1H-pyrimidin-2-yl)pyrazol-5-yl]-4,5-dimethoxy-2-nitrobenzamide (PubChem CID 136606222) has the molecular formula C21H18N6O7 and a molecular weight of 466.41 g/mol. Its IUPAC name is N-[3-(furan-2-yl)-1-(4-methyl-6-oxo-1H-pyrimidin-2-yl)pyrazol-5-yl]-4,5-dimethoxy-2-nitrobenzamide.
| Compound Name | N-[3-(furan-2-yl)-1-(4-methyl-6-oxo-1H-pyrimidin-2-yl)pyrazol-5-yl]-4,5-dimethoxy-2-nitrobenzamide |
|---|---|
| PubChem CID | 136606222 |
| Molecular Formula | C21H18N6O7 |
| Molecular Weight | 466.41 g/mol |
| Exact Mass | 466.12 |
| IUPAC Name | N-[3-(furan-2-yl)-1-(4-methyl-6-oxo-1H-pyrimidin-2-yl)pyrazol-5-yl]-4,5-dimethoxy-2-nitrobenzamide |
| SMILES | COc1cc(C(=O)Nc2cc(-c3ccco3)nn2-c2nc(C)cc(=O)[nH]2)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C21H18N6O7/c1-11-7-19(28)24-21(22-11)26-18(9-13(25-26)15-5-4-6-34-15)23-20(29)12-8-16(32-2)17(33-3)10-14(12)27(30)31/h4-10H,1-3H3,(H,23,29)(H,22,24,28) |
| InChIKey | LJVRZXBHOAISLP-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 167.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.41 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|