C21H16N6O5 — CID 136606224
(Z)-N-[3-(furan-2-yl)-1-(4-methyl-6-oxo-1H-pyrimidin-2-yl)pyrazol-5-yl]-3-(4-nitrophenyl)prop-2-enamide (PubChem CID 136606224) has the molecular formula C21H16N6O5 and a molecular weight of 432.40 g/mol. Its IUPAC name is (Z)-N-[3-(furan-2-yl)-1-(4-methyl-6-oxo-1H-pyrimidin-2-yl)pyrazol-5-yl]-3-(4-nitrophenyl)prop-2-enamide.
| Compound Name | (Z)-N-[3-(furan-2-yl)-1-(4-methyl-6-oxo-1H-pyrimidin-2-yl)pyrazol-5-yl]-3-(4-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 136606224 |
| Molecular Formula | C21H16N6O5 |
| Molecular Weight | 432.40 g/mol |
| Exact Mass | 432.12 |
| IUPAC Name | (Z)-N-[3-(furan-2-yl)-1-(4-methyl-6-oxo-1H-pyrimidin-2-yl)pyrazol-5-yl]-3-(4-nitrophenyl)prop-2-enamide |
| SMILES | Cc1cc(=O)[nH]c(-n2nc(-c3ccco3)cc2NC(=O)/C=C\c2ccc([N+](=O)[O-])cc2)n1 |
| InChI | InChI=1S/C21H16N6O5/c1-13-11-20(29)24-21(22-13)26-18(12-16(25-26)17-3-2-10-32-17)23-19(28)9-6-14-4-7-15(8-5-14)27(30)31/h2-12H,1H3,(H,23,28)(H,22,24,29)/b9-6- |
| InChIKey | AIZRRZVWEPTGBF-TWGQIWQCSA-N |
| XLogP | 3.08 |
| TPSA | 148.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.40 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|