C20H21ClN6O4 — CID 146053943
(E)-N-[2-(5-ethyl-4-methyl-6-oxo-1H-pyrimidin-2-yl)-5-methylpyrazol-3-yl]-3-(4-nitrophenyl)prop-2-enamide;hydrochloride (PubChem CID 146053943) has the molecular formula C20H21ClN6O4 and a molecular weight of 444.88 g/mol. Its IUPAC name is (E)-N-[2-(5-ethyl-4-methyl-6-oxo-1H-pyrimidin-2-yl)-5-methylpyrazol-3-yl]-3-(4-nitrophenyl)prop-2-enamide;hydrochloride.
| Compound Name | (E)-N-[2-(5-ethyl-4-methyl-6-oxo-1H-pyrimidin-2-yl)-5-methylpyrazol-3-yl]-3-(4-nitrophenyl)prop-2-enamide;hydrochloride |
|---|---|
| PubChem CID | 146053943 |
| Molecular Formula | C20H21ClN6O4 |
| Molecular Weight | 444.88 g/mol |
| Exact Mass | 444.13 |
| IUPAC Name | (E)-N-[2-(5-ethyl-4-methyl-6-oxo-1H-pyrimidin-2-yl)-5-methylpyrazol-3-yl]-3-(4-nitrophenyl)prop-2-enamide;hydrochloride |
| SMILES | CCc1c(C)nc(-n2nc(C)cc2NC(=O)/C=C/c2ccc([N+](=O)[O-])cc2)[nH]c1=O.Cl |
| InChI | InChI=1S/C20H20N6O4.ClH/c1-4-16-13(3)21-20(23-19(16)28)25-17(11-12(2)24-25)22-18(27)10-7-14-5-8-15(9-6-14)26(29)30;/h5-11H,4H2,1-3H3,(H,22,27)(H,21,23,28);1H/b10-7+; |
| InChIKey | KNACBZLHXOJOIE-HCUGZAAXSA-N |
| XLogP | 3.12 |
| TPSA | 135.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.88 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|