C21H19N5O4 — CID 55520007
(E)-3-(4-acetamidophenyl)-N-[5-methyl-2-(4-nitrophenyl)pyrazol-3-yl]prop-2-enamide (PubChem CID 55520007) has the molecular formula C21H19N5O4 and a molecular weight of 405.41 g/mol. Its IUPAC name is (E)-3-(4-acetamidophenyl)-N-[5-methyl-2-(4-nitrophenyl)pyrazol-3-yl]prop-2-enamide.
| Compound Name | (E)-3-(4-acetamidophenyl)-N-[5-methyl-2-(4-nitrophenyl)pyrazol-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 55520007 |
| Molecular Formula | C21H19N5O4 |
| Molecular Weight | 405.41 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | (E)-3-(4-acetamidophenyl)-N-[5-methyl-2-(4-nitrophenyl)pyrazol-3-yl]prop-2-enamide |
| SMILES | CC(=O)Nc1ccc(/C=C/C(=O)Nc2cc(C)nn2-c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C21H19N5O4/c1-14-13-20(25(24-14)18-8-10-19(11-9-18)26(29)30)23-21(28)12-5-16-3-6-17(7-4-16)22-15(2)27/h3-13H,1-2H3,(H,22,27)(H,23,28)/b12-5+ |
| InChIKey | PHHXRWLSEFXUDG-LFYBBSHMSA-N |
| XLogP | 3.70 |
| TPSA | 119.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.41 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|