C17H18N4O5S — CID 51194421
(E)-N-[2-(1,1-dioxothiolan-3-yl)-5-methylpyrazol-3-yl]-3-(4-nitrophenyl)prop-2-enamide (PubChem CID 51194421) has the molecular formula C17H18N4O5S and a molecular weight of 390.42 g/mol. Its IUPAC name is (E)-N-[2-(1,1-dioxothiolan-3-yl)-5-methylpyrazol-3-yl]-3-(4-nitrophenyl)prop-2-enamide.
| Compound Name | (E)-N-[2-(1,1-dioxothiolan-3-yl)-5-methylpyrazol-3-yl]-3-(4-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 51194421 |
| Molecular Formula | C17H18N4O5S |
| Molecular Weight | 390.42 g/mol |
| Exact Mass | 390.10 |
| IUPAC Name | (E)-N-[2-(1,1-dioxothiolan-3-yl)-5-methylpyrazol-3-yl]-3-(4-nitrophenyl)prop-2-enamide |
| SMILES | Cc1cc(NC(=O)/C=C/c2ccc([N+](=O)[O-])cc2)n(C2CCS(=O)(=O)C2)n1 |
| InChI | InChI=1S/C17H18N4O5S/c1-12-10-16(20(19-12)15-8-9-27(25,26)11-15)18-17(22)7-4-13-2-5-14(6-3-13)21(23)24/h2-7,10,15H,8-9,11H2,1H3,(H,18,22)/b7-4+ |
| InChIKey | BMDVCMDAVMTUIN-QPJJXVBHSA-N |
| XLogP | 2.11 |
| TPSA | 124.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.42 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|