C21H24N4O4S — CID 55571180
N-cyclopropyl-4-[(E)-3-[[2-(1,1-dioxothiolan-3-yl)-5-methylpyrazol-3-yl]amino]-3-oxoprop-1-enyl]benzamide (PubChem CID 55571180) has the molecular formula C21H24N4O4S and a molecular weight of 428.51 g/mol. Its IUPAC name is N-cyclopropyl-4-[(E)-3-[[2-(1,1-dioxothiolan-3-yl)-5-methylpyrazol-3-yl]amino]-3-oxoprop-1-enyl]benzamide.
| Compound Name | N-cyclopropyl-4-[(E)-3-[[2-(1,1-dioxothiolan-3-yl)-5-methylpyrazol-3-yl]amino]-3-oxoprop-1-enyl]benzamide |
|---|---|
| PubChem CID | 55571180 |
| Molecular Formula | C21H24N4O4S |
| Molecular Weight | 428.51 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | N-cyclopropyl-4-[(E)-3-[[2-(1,1-dioxothiolan-3-yl)-5-methylpyrazol-3-yl]amino]-3-oxoprop-1-enyl]benzamide |
| SMILES | Cc1cc(NC(=O)/C=C/c2ccc(C(=O)NC3CC3)cc2)n(C2CCS(=O)(=O)C2)n1 |
| InChI | InChI=1S/C21H24N4O4S/c1-14-12-19(25(24-14)18-10-11-30(28,29)13-18)23-20(26)9-4-15-2-5-16(6-3-15)21(27)22-17-7-8-17/h2-6,9,12,17-18H,7-8,10-11,13H2,1H3,(H,22,27)(H,23,26)/b9-4+ |
| InChIKey | OTHBJRCKFDWZFE-RUDMXATFSA-N |
| XLogP | 2.10 |
| TPSA | 110.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.51 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|