C18H18F3N3O3S2 — CID 51934358
(E)-N-[2-[(3R)-1,1-dioxothiolan-3-yl]-5-methylpyrazol-3-yl]-3-[4-(trifluoromethylsulfanyl)phenyl]prop-2-enamide (PubChem CID 51934358) has the molecular formula C18H18F3N3O3S2 and a molecular weight of 445.49 g/mol. Its IUPAC name is (E)-N-[2-[(3R)-1,1-dioxothiolan-3-yl]-5-methylpyrazol-3-yl]-3-[4-(trifluoromethylsulfanyl)phenyl]prop-2-enamide.
| Compound Name | (E)-N-[2-[(3R)-1,1-dioxothiolan-3-yl]-5-methylpyrazol-3-yl]-3-[4-(trifluoromethylsulfanyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 51934358 |
| Molecular Formula | C18H18F3N3O3S2 |
| Molecular Weight | 445.49 g/mol |
| Exact Mass | 445.07 |
| IUPAC Name | (E)-N-[2-[(3R)-1,1-dioxothiolan-3-yl]-5-methylpyrazol-3-yl]-3-[4-(trifluoromethylsulfanyl)phenyl]prop-2-enamide |
| SMILES | Cc1cc(NC(=O)/C=C/c2ccc(SC(F)(F)F)cc2)n([C@@H]2CCS(=O)(=O)C2)n1 |
| InChI | InChI=1S/C18H18F3N3O3S2/c1-12-10-16(24(23-12)14-8-9-29(26,27)11-14)22-17(25)7-4-13-2-5-15(6-3-13)28-18(19,20)21/h2-7,10,14H,8-9,11H2,1H3,(H,22,25)/b7-4+/t14-/m1/s1 |
| InChIKey | ZCXFMUMHGVAHFW-BTKRWWFXSA-N |
| XLogP | 3.81 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.49 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|