C18H19N5O3S — CID 47785451
N-[2-(1,1-dioxothiolan-3-yl)-5-methylpyrazol-3-yl]-4-imidazol-1-ylbenzamide (PubChem CID 47785451) has the molecular formula C18H19N5O3S and a molecular weight of 385.45 g/mol. Its IUPAC name is N-[2-(1,1-dioxothiolan-3-yl)-5-methylpyrazol-3-yl]-4-imidazol-1-ylbenzamide.
| Compound Name | N-[2-(1,1-dioxothiolan-3-yl)-5-methylpyrazol-3-yl]-4-imidazol-1-ylbenzamide |
|---|---|
| PubChem CID | 47785451 |
| Molecular Formula | C18H19N5O3S |
| Molecular Weight | 385.45 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | N-[2-(1,1-dioxothiolan-3-yl)-5-methylpyrazol-3-yl]-4-imidazol-1-ylbenzamide |
| SMILES | Cc1cc(NC(=O)c2ccc(-n3ccnc3)cc2)n(C2CCS(=O)(=O)C2)n1 |
| InChI | InChI=1S/C18H19N5O3S/c1-13-10-17(23(21-13)16-6-9-27(25,26)11-16)20-18(24)14-2-4-15(5-3-14)22-8-7-19-12-22/h2-5,7-8,10,12,16H,6,9,11H2,1H3,(H,20,24) |
| InChIKey | MCNQPPSYHWOQCR-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 98.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.45 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |