C18H19N5O7S — CID 55571632
N-[2-(1,1-dioxothiolan-3-yl)-5-methylpyrazol-3-yl]-2-(6-nitro-3-oxo-1,4-benzoxazin-4-yl)acetamide (PubChem CID 55571632) has the molecular formula C18H19N5O7S and a molecular weight of 449.45 g/mol. Its IUPAC name is N-[2-(1,1-dioxothiolan-3-yl)-5-methylpyrazol-3-yl]-2-(6-nitro-3-oxo-1,4-benzoxazin-4-yl)acetamide.
| Compound Name | N-[2-(1,1-dioxothiolan-3-yl)-5-methylpyrazol-3-yl]-2-(6-nitro-3-oxo-1,4-benzoxazin-4-yl)acetamide |
|---|---|
| PubChem CID | 55571632 |
| Molecular Formula | C18H19N5O7S |
| Molecular Weight | 449.45 g/mol |
| Exact Mass | 449.10 |
| IUPAC Name | N-[2-(1,1-dioxothiolan-3-yl)-5-methylpyrazol-3-yl]-2-(6-nitro-3-oxo-1,4-benzoxazin-4-yl)acetamide |
| SMILES | Cc1cc(NC(=O)CN2C(=O)COc3ccc([N+](=O)[O-])cc32)n(C2CCS(=O)(=O)C2)n1 |
| InChI | InChI=1S/C18H19N5O7S/c1-11-6-16(22(20-11)13-4-5-31(28,29)10-13)19-17(24)8-21-14-7-12(23(26)27)2-3-15(14)30-9-18(21)25/h2-3,6-7,13H,4-5,8-10H2,1H3,(H,19,24) |
| InChIKey | GJHWMYOSNYTFKC-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 153.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.45 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|