C14H17ClN4O5 — CID 119450285
2-(6-nitro-3-oxo-1,4-benzoxazin-4-yl)-N-pyrrolidin-3-ylacetamide;hydrochloride (PubChem CID 119450285) has the molecular formula C14H17ClN4O5 and a molecular weight of 356.77 g/mol. Its IUPAC name is 2-(6-nitro-3-oxo-1,4-benzoxazin-4-yl)-N-pyrrolidin-3-ylacetamide;hydrochloride.
| Compound Name | 2-(6-nitro-3-oxo-1,4-benzoxazin-4-yl)-N-pyrrolidin-3-ylacetamide;hydrochloride |
|---|---|
| PubChem CID | 119450285 |
| Molecular Formula | C14H17ClN4O5 |
| Molecular Weight | 356.77 g/mol |
| Exact Mass | 356.09 |
| IUPAC Name | 2-(6-nitro-3-oxo-1,4-benzoxazin-4-yl)-N-pyrrolidin-3-ylacetamide;hydrochloride |
| SMILES | Cl.O=C(CN1C(=O)COc2ccc([N+](=O)[O-])cc21)NC1CCNC1 |
| InChI | InChI=1S/C14H16N4O5.ClH/c19-13(16-9-3-4-15-6-9)7-17-11-5-10(18(21)22)1-2-12(11)23-8-14(17)20;/h1-2,5,9,15H,3-4,6-8H2,(H,16,19);1H |
| InChIKey | FIULAMHPBWOKFX-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 113.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.77 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|