C17H20F2N4O5 — CID 49073929
N-[1-(2,2-difluoroethyl)piperidin-4-yl]-2-(6-nitro-3-oxo-1,4-benzoxazin-4-yl)acetamide (PubChem CID 49073929) has the molecular formula C17H20F2N4O5 and a molecular weight of 398.37 g/mol. Its IUPAC name is N-[1-(2,2-difluoroethyl)piperidin-4-yl]-2-(6-nitro-3-oxo-1,4-benzoxazin-4-yl)acetamide.
| Compound Name | N-[1-(2,2-difluoroethyl)piperidin-4-yl]-2-(6-nitro-3-oxo-1,4-benzoxazin-4-yl)acetamide |
|---|---|
| PubChem CID | 49073929 |
| Molecular Formula | C17H20F2N4O5 |
| Molecular Weight | 398.37 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | N-[1-(2,2-difluoroethyl)piperidin-4-yl]-2-(6-nitro-3-oxo-1,4-benzoxazin-4-yl)acetamide |
| SMILES | O=C(CN1C(=O)COc2ccc([N+](=O)[O-])cc21)NC1CCN(CC(F)F)CC1 |
| InChI | InChI=1S/C17H20F2N4O5/c18-15(19)8-21-5-3-11(4-6-21)20-16(24)9-22-13-7-12(23(26)27)1-2-14(13)28-10-17(22)25/h1-2,7,11,15H,3-6,8-10H2,(H,20,24) |
| InChIKey | MYHNIXGQPNXBNZ-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 105.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.37 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|