C16H21ClN4O5 — CID 119601338
N-[2-(aminomethyl)cyclopentyl]-2-(6-nitro-3-oxo-1,4-benzoxazin-4-yl)acetamide;hydrochloride (PubChem CID 119601338) has the molecular formula C16H21ClN4O5 and a molecular weight of 384.82 g/mol. Its IUPAC name is N-[2-(aminomethyl)cyclopentyl]-2-(6-nitro-3-oxo-1,4-benzoxazin-4-yl)acetamide;hydrochloride.
| Compound Name | N-[2-(aminomethyl)cyclopentyl]-2-(6-nitro-3-oxo-1,4-benzoxazin-4-yl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 119601338 |
| Molecular Formula | C16H21ClN4O5 |
| Molecular Weight | 384.82 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | N-[2-(aminomethyl)cyclopentyl]-2-(6-nitro-3-oxo-1,4-benzoxazin-4-yl)acetamide;hydrochloride |
| SMILES | Cl.NCC1CCCC1NC(=O)CN1C(=O)COc2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C16H20N4O5.ClH/c17-7-10-2-1-3-12(10)18-15(21)8-19-13-6-11(20(23)24)4-5-14(13)25-9-16(19)22;/h4-6,10,12H,1-3,7-9,17H2,(H,18,21);1H |
| InChIKey | MLGDZQDADGTTEH-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 127.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.82 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|