C18H21N3O7 — CID 120538806
1-[[2-(6-nitro-3-oxo-1,4-benzoxazin-4-yl)acetyl]amino]cycloheptane-1-carboxylic acid (PubChem CID 120538806) has the molecular formula C18H21N3O7 and a molecular weight of 391.38 g/mol. Its IUPAC name is 1-[[2-(6-nitro-3-oxo-1,4-benzoxazin-4-yl)acetyl]amino]cycloheptane-1-carboxylic acid.
| Compound Name | 1-[[2-(6-nitro-3-oxo-1,4-benzoxazin-4-yl)acetyl]amino]cycloheptane-1-carboxylic acid |
|---|---|
| PubChem CID | 120538806 |
| Molecular Formula | C18H21N3O7 |
| Molecular Weight | 391.38 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | 1-[[2-(6-nitro-3-oxo-1,4-benzoxazin-4-yl)acetyl]amino]cycloheptane-1-carboxylic acid |
| SMILES | O=C(CN1C(=O)COc2ccc([N+](=O)[O-])cc21)NC1(C(=O)O)CCCCCC1 |
| InChI | InChI=1S/C18H21N3O7/c22-15(19-18(17(24)25)7-3-1-2-4-8-18)10-20-13-9-12(21(26)27)5-6-14(13)28-11-16(20)23/h5-6,9H,1-4,7-8,10-11H2,(H,19,22)(H,24,25) |
| InChIKey | DKQINBHXJFKMHN-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 139.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.38 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|