C16H19N3O7 — CID 119204192
4-methyl-4-[[2-(6-nitro-3-oxo-1,4-benzoxazin-4-yl)acetyl]amino]pentanoic acid (PubChem CID 119204192) has the molecular formula C16H19N3O7 and a molecular weight of 365.34 g/mol. Its IUPAC name is 4-methyl-4-[[2-(6-nitro-3-oxo-1,4-benzoxazin-4-yl)acetyl]amino]pentanoic acid.
| Compound Name | 4-methyl-4-[[2-(6-nitro-3-oxo-1,4-benzoxazin-4-yl)acetyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 119204192 |
| Molecular Formula | C16H19N3O7 |
| Molecular Weight | 365.34 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | 4-methyl-4-[[2-(6-nitro-3-oxo-1,4-benzoxazin-4-yl)acetyl]amino]pentanoic acid |
| SMILES | CC(C)(CCC(=O)O)NC(=O)CN1C(=O)COc2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C16H19N3O7/c1-16(2,6-5-15(22)23)17-13(20)8-18-11-7-10(19(24)25)3-4-12(11)26-9-14(18)21/h3-4,7H,5-6,8-9H2,1-2H3,(H,17,20)(H,22,23) |
| InChIKey | LWQWLIIQALRCSY-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 139.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.34 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|