C21H28N4O6 — CID 31328585
N-[(1-morpholin-4-ylcyclohexyl)methyl]-2-(6-nitro-3-oxo-1,4-benzoxazin-4-yl)acetamide (PubChem CID 31328585) has the molecular formula C21H28N4O6 and a molecular weight of 432.48 g/mol. Its IUPAC name is N-[(1-morpholin-4-ylcyclohexyl)methyl]-2-(6-nitro-3-oxo-1,4-benzoxazin-4-yl)acetamide.
| Compound Name | N-[(1-morpholin-4-ylcyclohexyl)methyl]-2-(6-nitro-3-oxo-1,4-benzoxazin-4-yl)acetamide |
|---|---|
| PubChem CID | 31328585 |
| Molecular Formula | C21H28N4O6 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.20 |
| IUPAC Name | N-[(1-morpholin-4-ylcyclohexyl)methyl]-2-(6-nitro-3-oxo-1,4-benzoxazin-4-yl)acetamide |
| SMILES | O=C(CN1C(=O)COc2ccc([N+](=O)[O-])cc21)NCC1(N2CCOCC2)CCCCC1 |
| InChI | InChI=1S/C21H28N4O6/c26-19(22-15-21(6-2-1-3-7-21)23-8-10-30-11-9-23)13-24-17-12-16(25(28)29)4-5-18(17)31-14-20(24)27/h4-5,12H,1-3,6-11,13-15H2,(H,22,26) |
| InChIKey | DLIXLOKGXKBQIN-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 114.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|