C16H22ClN5O5 — CID 119445560
2-(6-nitro-3-oxo-1,4-benzoxazin-4-yl)-N-(2-piperazin-1-ylethyl)acetamide;hydrochloride (PubChem CID 119445560) has the molecular formula C16H22ClN5O5 and a molecular weight of 399.84 g/mol. Its IUPAC name is 2-(6-nitro-3-oxo-1,4-benzoxazin-4-yl)-N-(2-piperazin-1-ylethyl)acetamide;hydrochloride.
| Compound Name | 2-(6-nitro-3-oxo-1,4-benzoxazin-4-yl)-N-(2-piperazin-1-ylethyl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 119445560 |
| Molecular Formula | C16H22ClN5O5 |
| Molecular Weight | 399.84 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | 2-(6-nitro-3-oxo-1,4-benzoxazin-4-yl)-N-(2-piperazin-1-ylethyl)acetamide;hydrochloride |
| SMILES | Cl.O=C(CN1C(=O)COc2ccc([N+](=O)[O-])cc21)NCCN1CCNCC1 |
| InChI | InChI=1S/C16H21N5O5.ClH/c22-15(18-5-8-19-6-3-17-4-7-19)10-20-13-9-12(21(24)25)1-2-14(13)26-11-16(20)23;/h1-2,9,17H,3-8,10-11H2,(H,18,22);1H |
| InChIKey | DQJBUASVKLFZKQ-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 117.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.84 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|