C19H19N3O5 — CID 35806835
2-(6-nitro-3-oxo-1,4-benzoxazin-4-yl)-N-(3-phenylpropyl)acetamide (PubChem CID 35806835) has the molecular formula C19H19N3O5 and a molecular weight of 369.38 g/mol. Its IUPAC name is 2-(6-nitro-3-oxo-1,4-benzoxazin-4-yl)-N-(3-phenylpropyl)acetamide.
| Compound Name | 2-(6-nitro-3-oxo-1,4-benzoxazin-4-yl)-N-(3-phenylpropyl)acetamide |
|---|---|
| PubChem CID | 35806835 |
| Molecular Formula | C19H19N3O5 |
| Molecular Weight | 369.38 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | 2-(6-nitro-3-oxo-1,4-benzoxazin-4-yl)-N-(3-phenylpropyl)acetamide |
| SMILES | O=C(CN1C(=O)COc2ccc([N+](=O)[O-])cc21)NCCCc1ccccc1 |
| InChI | InChI=1S/C19H19N3O5/c23-18(20-10-4-7-14-5-2-1-3-6-14)12-21-16-11-15(22(25)26)8-9-17(16)27-13-19(21)24/h1-3,5-6,8-9,11H,4,7,10,12-13H2,(H,20,23) |
| InChIKey | LWOJDDJFVIDNTD-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.38 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|