C19H16N6O5 — CID 55856777
N-(1-benzyl-1,2,4-triazol-3-yl)-2-(6-nitro-3-oxo-1,4-benzoxazin-4-yl)acetamide (PubChem CID 55856777) has the molecular formula C19H16N6O5 and a molecular weight of 408.37 g/mol. Its IUPAC name is N-(1-benzyl-1,2,4-triazol-3-yl)-2-(6-nitro-3-oxo-1,4-benzoxazin-4-yl)acetamide.
| Compound Name | N-(1-benzyl-1,2,4-triazol-3-yl)-2-(6-nitro-3-oxo-1,4-benzoxazin-4-yl)acetamide |
|---|---|
| PubChem CID | 55856777 |
| Molecular Formula | C19H16N6O5 |
| Molecular Weight | 408.37 g/mol |
| Exact Mass | 408.12 |
| IUPAC Name | N-(1-benzyl-1,2,4-triazol-3-yl)-2-(6-nitro-3-oxo-1,4-benzoxazin-4-yl)acetamide |
| SMILES | O=C(CN1C(=O)COc2ccc([N+](=O)[O-])cc21)Nc1ncn(Cc2ccccc2)n1 |
| InChI | InChI=1S/C19H16N6O5/c26-17(21-19-20-12-23(22-19)9-13-4-2-1-3-5-13)10-24-15-8-14(25(28)29)6-7-16(15)30-11-18(24)27/h1-8,12H,9-11H2,(H,21,22,26) |
| InChIKey | AUSWRGXDVIJBQM-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 132.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.37 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|