C22H18N4O8 — CID 31837670
N'-[2-(6-nitro-3-oxo-1,4-benzoxazin-4-yl)acetyl]-5-(phenoxymethyl)furan-2-carbohydrazide (PubChem CID 31837670) has the molecular formula C22H18N4O8 and a molecular weight of 466.41 g/mol. Its IUPAC name is N'-[2-(6-nitro-3-oxo-1,4-benzoxazin-4-yl)acetyl]-5-(phenoxymethyl)furan-2-carbohydrazide.
| Compound Name | N'-[2-(6-nitro-3-oxo-1,4-benzoxazin-4-yl)acetyl]-5-(phenoxymethyl)furan-2-carbohydrazide |
|---|---|
| PubChem CID | 31837670 |
| Molecular Formula | C22H18N4O8 |
| Molecular Weight | 466.41 g/mol |
| Exact Mass | 466.11 |
| IUPAC Name | N'-[2-(6-nitro-3-oxo-1,4-benzoxazin-4-yl)acetyl]-5-(phenoxymethyl)furan-2-carbohydrazide |
| SMILES | O=C(CN1C(=O)COc2ccc([N+](=O)[O-])cc21)NNC(=O)c1ccc(COc2ccccc2)o1 |
| InChI | InChI=1S/C22H18N4O8/c27-20(11-25-17-10-14(26(30)31)6-8-18(17)33-13-21(25)28)23-24-22(29)19-9-7-16(34-19)12-32-15-4-2-1-3-5-15/h1-10H,11-13H2,(H,23,27)(H,24,29) |
| InChIKey | CZJOAMSYALUQAV-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 153.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.41 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|