C19H18N4O6 — CID 9084851
2,4-dimethyl-N'-[2-(6-nitro-3-oxo-1,4-benzoxazin-4-yl)acetyl]benzohydrazide (PubChem CID 9084851) has the molecular formula C19H18N4O6 and a molecular weight of 398.38 g/mol. Its IUPAC name is 2,4-dimethyl-N'-[2-(6-nitro-3-oxo-1,4-benzoxazin-4-yl)acetyl]benzohydrazide.
| Compound Name | 2,4-dimethyl-N'-[2-(6-nitro-3-oxo-1,4-benzoxazin-4-yl)acetyl]benzohydrazide |
|---|---|
| PubChem CID | 9084851 |
| Molecular Formula | C19H18N4O6 |
| Molecular Weight | 398.38 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | 2,4-dimethyl-N'-[2-(6-nitro-3-oxo-1,4-benzoxazin-4-yl)acetyl]benzohydrazide |
| SMILES | Cc1ccc(C(=O)NNC(=O)CN2C(=O)COc3ccc([N+](=O)[O-])cc32)c(C)c1 |
| InChI | InChI=1S/C19H18N4O6/c1-11-3-5-14(12(2)7-11)19(26)21-20-17(24)9-22-15-8-13(23(27)28)4-6-16(15)29-10-18(22)25/h3-8H,9-10H2,1-2H3,(H,20,24)(H,21,26) |
| InChIKey | WBYUHFUYBFCXRQ-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 130.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.38 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|