C17H13FN4O6 — CID 9084745
2-fluoro-N'-[2-(6-nitro-3-oxo-1,4-benzoxazin-4-yl)acetyl]benzohydrazide (PubChem CID 9084745) has the molecular formula C17H13FN4O6 and a molecular weight of 388.31 g/mol. Its IUPAC name is 2-fluoro-N'-[2-(6-nitro-3-oxo-1,4-benzoxazin-4-yl)acetyl]benzohydrazide.
| Compound Name | 2-fluoro-N'-[2-(6-nitro-3-oxo-1,4-benzoxazin-4-yl)acetyl]benzohydrazide |
|---|---|
| PubChem CID | 9084745 |
| Molecular Formula | C17H13FN4O6 |
| Molecular Weight | 388.31 g/mol |
| Exact Mass | 388.08 |
| IUPAC Name | 2-fluoro-N'-[2-(6-nitro-3-oxo-1,4-benzoxazin-4-yl)acetyl]benzohydrazide |
| SMILES | O=C(CN1C(=O)COc2ccc([N+](=O)[O-])cc21)NNC(=O)c1ccccc1F |
| InChI | InChI=1S/C17H13FN4O6/c18-12-4-2-1-3-11(12)17(25)20-19-15(23)8-21-13-7-10(22(26)27)5-6-14(13)28-9-16(21)24/h1-7H,8-9H2,(H,19,23)(H,20,25) |
| InChIKey | LJBKXJNHTQUNCA-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 130.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.31 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|