C16H11Cl2N3O5 — CID 17430908
N-(2,5-dichlorophenyl)-2-(6-nitro-3-oxo-1,4-benzoxazin-4-yl)acetamide (PubChem CID 17430908) has the molecular formula C16H11Cl2N3O5 and a molecular weight of 396.19 g/mol. Its IUPAC name is N-(2,5-dichlorophenyl)-2-(6-nitro-3-oxo-1,4-benzoxazin-4-yl)acetamide.
| Compound Name | N-(2,5-dichlorophenyl)-2-(6-nitro-3-oxo-1,4-benzoxazin-4-yl)acetamide |
|---|---|
| PubChem CID | 17430908 |
| Molecular Formula | C16H11Cl2N3O5 |
| Molecular Weight | 396.19 g/mol |
| Exact Mass | 395.01 |
| IUPAC Name | N-(2,5-dichlorophenyl)-2-(6-nitro-3-oxo-1,4-benzoxazin-4-yl)acetamide |
| SMILES | O=C(CN1C(=O)COc2ccc([N+](=O)[O-])cc21)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C16H11Cl2N3O5/c17-9-1-3-11(18)12(5-9)19-15(22)7-20-13-6-10(21(24)25)2-4-14(13)26-8-16(20)23/h1-6H,7-8H2,(H,19,22) |
| InChIKey | JBXSUWGCIIBMNA-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.19 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|