C16H19N3O5 — CID 17417985
4-[2-(3-methylpiperidin-1-yl)-2-oxoethyl]-6-nitro-1,4-benzoxazin-3-one (PubChem CID 17417985) has the molecular formula C16H19N3O5 and a molecular weight of 333.34 g/mol. Its IUPAC name is 4-[2-(3-methylpiperidin-1-yl)-2-oxoethyl]-6-nitro-1,4-benzoxazin-3-one.
| Compound Name | 4-[2-(3-methylpiperidin-1-yl)-2-oxoethyl]-6-nitro-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 17417985 |
| Molecular Formula | C16H19N3O5 |
| Molecular Weight | 333.34 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | 4-[2-(3-methylpiperidin-1-yl)-2-oxoethyl]-6-nitro-1,4-benzoxazin-3-one |
| SMILES | CC1CCCN(C(=O)CN2C(=O)COc3ccc([N+](=O)[O-])cc32)C1 |
| InChI | InChI=1S/C16H19N3O5/c1-11-3-2-6-17(8-11)15(20)9-18-13-7-12(19(22)23)4-5-14(13)24-10-16(18)21/h4-5,7,11H,2-3,6,8-10H2,1H3 |
| InChIKey | XCKUFAQNXJYRII-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 92.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.34 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|