C20H21N5O6S — CID 55951639
N-(4-methyl-1,3-thiazol-2-yl)-1-[2-(6-nitro-3-oxo-1,4-benzoxazin-4-yl)acetyl]piperidine-4-carboxamide (PubChem CID 55951639) has the molecular formula C20H21N5O6S and a molecular weight of 459.48 g/mol. Its IUPAC name is N-(4-methyl-1,3-thiazol-2-yl)-1-[2-(6-nitro-3-oxo-1,4-benzoxazin-4-yl)acetyl]piperidine-4-carboxamide.
| Compound Name | N-(4-methyl-1,3-thiazol-2-yl)-1-[2-(6-nitro-3-oxo-1,4-benzoxazin-4-yl)acetyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55951639 |
| Molecular Formula | C20H21N5O6S |
| Molecular Weight | 459.48 g/mol |
| Exact Mass | 459.12 |
| IUPAC Name | N-(4-methyl-1,3-thiazol-2-yl)-1-[2-(6-nitro-3-oxo-1,4-benzoxazin-4-yl)acetyl]piperidine-4-carboxamide |
| SMILES | Cc1csc(NC(=O)C2CCN(C(=O)CN3C(=O)COc4ccc([N+](=O)[O-])cc43)CC2)n1 |
| InChI | InChI=1S/C20H21N5O6S/c1-12-11-32-20(21-12)22-19(28)13-4-6-23(7-5-13)17(26)9-24-15-8-14(25(29)30)2-3-16(15)31-10-18(24)27/h2-3,8,11,13H,4-7,9-10H2,1H3,(H,21,22,28) |
| InChIKey | FKGRYDFREHFEFC-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 134.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.48 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|