C19H13FN4O5S — CID 36666966
N-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-2-(6-nitro-3-oxo-1,4-benzoxazin-4-yl)acetamide (PubChem CID 36666966) has the molecular formula C19H13FN4O5S and a molecular weight of 428.40 g/mol. Its IUPAC name is N-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-2-(6-nitro-3-oxo-1,4-benzoxazin-4-yl)acetamide.
| Compound Name | N-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-2-(6-nitro-3-oxo-1,4-benzoxazin-4-yl)acetamide |
|---|---|
| PubChem CID | 36666966 |
| Molecular Formula | C19H13FN4O5S |
| Molecular Weight | 428.40 g/mol |
| Exact Mass | 428.06 |
| IUPAC Name | N-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-2-(6-nitro-3-oxo-1,4-benzoxazin-4-yl)acetamide |
| SMILES | O=C(CN1C(=O)COc2ccc([N+](=O)[O-])cc21)Nc1nc(-c2ccc(F)cc2)cs1 |
| InChI | InChI=1S/C19H13FN4O5S/c20-12-3-1-11(2-4-12)14-10-30-19(21-14)22-17(25)8-23-15-7-13(24(27)28)5-6-16(15)29-9-18(23)26/h1-7,10H,8-9H2,(H,21,22,25) |
| InChIKey | GPEBCJGEXYQPFP-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 114.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.40 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|