C19H14N4O5S — CID 39086120
N-(4-nitrophenyl)-2-[3-oxo-6-(1,3-thiazol-4-yl)-1,4-benzoxazin-4-yl]acetamide (PubChem CID 39086120) has the molecular formula C19H14N4O5S and a molecular weight of 410.41 g/mol. Its IUPAC name is N-(4-nitrophenyl)-2-[3-oxo-6-(1,3-thiazol-4-yl)-1,4-benzoxazin-4-yl]acetamide.
| Compound Name | N-(4-nitrophenyl)-2-[3-oxo-6-(1,3-thiazol-4-yl)-1,4-benzoxazin-4-yl]acetamide |
|---|---|
| PubChem CID | 39086120 |
| Molecular Formula | C19H14N4O5S |
| Molecular Weight | 410.41 g/mol |
| Exact Mass | 410.07 |
| IUPAC Name | N-(4-nitrophenyl)-2-[3-oxo-6-(1,3-thiazol-4-yl)-1,4-benzoxazin-4-yl]acetamide |
| SMILES | O=C(CN1C(=O)COc2ccc(-c3cscn3)cc21)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H14N4O5S/c24-18(21-13-2-4-14(5-3-13)23(26)27)8-22-16-7-12(15-10-29-11-20-15)1-6-17(16)28-9-19(22)25/h1-7,10-11H,8-9H2,(H,21,24) |
| InChIKey | LZBUKEPUXUWTEX-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 114.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.41 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|