C16H16N2O5S — CID 39086298
2-methoxyethyl 2-[3-oxo-6-(1,3-thiazol-4-yl)-1,4-benzoxazin-4-yl]acetate (PubChem CID 39086298) has the molecular formula C16H16N2O5S and a molecular weight of 348.38 g/mol. Its IUPAC name is 2-methoxyethyl 2-[3-oxo-6-(1,3-thiazol-4-yl)-1,4-benzoxazin-4-yl]acetate.
| Compound Name | 2-methoxyethyl 2-[3-oxo-6-(1,3-thiazol-4-yl)-1,4-benzoxazin-4-yl]acetate |
|---|---|
| PubChem CID | 39086298 |
| Molecular Formula | C16H16N2O5S |
| Molecular Weight | 348.38 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | 2-methoxyethyl 2-[3-oxo-6-(1,3-thiazol-4-yl)-1,4-benzoxazin-4-yl]acetate |
| SMILES | COCCOC(=O)CN1C(=O)COc2ccc(-c3cscn3)cc21 |
| InChI | InChI=1S/C16H16N2O5S/c1-21-4-5-22-16(20)7-18-13-6-11(12-9-24-10-17-12)2-3-14(13)23-8-15(18)19/h2-3,6,9-10H,4-5,7-8H2,1H3 |
| InChIKey | TYJRYGIHOPGQBC-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 77.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.38 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|