C22H20N2O4S — CID 39086338
propyl 3-[[3-oxo-6-(1,3-thiazol-4-yl)-1,4-benzoxazin-4-yl]methyl]benzoate (PubChem CID 39086338) has the molecular formula C22H20N2O4S and a molecular weight of 408.48 g/mol. Its IUPAC name is propyl 3-[[3-oxo-6-(1,3-thiazol-4-yl)-1,4-benzoxazin-4-yl]methyl]benzoate.
| Compound Name | propyl 3-[[3-oxo-6-(1,3-thiazol-4-yl)-1,4-benzoxazin-4-yl]methyl]benzoate |
|---|---|
| PubChem CID | 39086338 |
| Molecular Formula | C22H20N2O4S |
| Molecular Weight | 408.48 g/mol |
| Exact Mass | 408.11 |
| IUPAC Name | propyl 3-[[3-oxo-6-(1,3-thiazol-4-yl)-1,4-benzoxazin-4-yl]methyl]benzoate |
| SMILES | CCCOC(=O)c1cccc(CN2C(=O)COc3ccc(-c4cscn4)cc32)c1 |
| InChI | InChI=1S/C22H20N2O4S/c1-2-8-27-22(26)17-5-3-4-15(9-17)11-24-19-10-16(18-13-29-14-23-18)6-7-20(19)28-12-21(24)25/h3-7,9-10,13-14H,2,8,11-12H2,1H3 |
| InChIKey | MFAWHYMXEJHJHN-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.48 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |