C19H22N2O5S — CID 28695956
2-propoxyethyl 2-[6-(2-methyl-1,3-thiazol-4-yl)-3-oxo-1,4-benzoxazin-4-yl]acetate (PubChem CID 28695956) has the molecular formula C19H22N2O5S and a molecular weight of 390.46 g/mol. Its IUPAC name is 2-propoxyethyl 2-[6-(2-methyl-1,3-thiazol-4-yl)-3-oxo-1,4-benzoxazin-4-yl]acetate.
| Compound Name | 2-propoxyethyl 2-[6-(2-methyl-1,3-thiazol-4-yl)-3-oxo-1,4-benzoxazin-4-yl]acetate |
|---|---|
| PubChem CID | 28695956 |
| Molecular Formula | C19H22N2O5S |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | 2-propoxyethyl 2-[6-(2-methyl-1,3-thiazol-4-yl)-3-oxo-1,4-benzoxazin-4-yl]acetate |
| SMILES | CCCOCCOC(=O)CN1C(=O)COc2ccc(-c3csc(C)n3)cc21 |
| InChI | InChI=1S/C19H22N2O5S/c1-3-6-24-7-8-25-19(23)10-21-16-9-14(15-12-27-13(2)20-15)4-5-17(16)26-11-18(21)22/h4-5,9,12H,3,6-8,10-11H2,1-2H3 |
| InChIKey | LBJKQJSDHZYFAA-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 77.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|