C20H25N5O4S — CID 55856375
1-[3-(2-methyl-5-nitroanilino)-3-oxopropyl]-N-(4-methyl-1,3-thiazol-2-yl)piperidine-4-carboxamide (PubChem CID 55856375) has the molecular formula C20H25N5O4S and a molecular weight of 431.52 g/mol. Its IUPAC name is 1-[3-(2-methyl-5-nitroanilino)-3-oxopropyl]-N-(4-methyl-1,3-thiazol-2-yl)piperidine-4-carboxamide.
| Compound Name | 1-[3-(2-methyl-5-nitroanilino)-3-oxopropyl]-N-(4-methyl-1,3-thiazol-2-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55856375 |
| Molecular Formula | C20H25N5O4S |
| Molecular Weight | 431.52 g/mol |
| Exact Mass | 431.16 |
| IUPAC Name | 1-[3-(2-methyl-5-nitroanilino)-3-oxopropyl]-N-(4-methyl-1,3-thiazol-2-yl)piperidine-4-carboxamide |
| SMILES | Cc1csc(NC(=O)C2CCN(CCC(=O)Nc3cc([N+](=O)[O-])ccc3C)CC2)n1 |
| InChI | InChI=1S/C20H25N5O4S/c1-13-3-4-16(25(28)29)11-17(13)22-18(26)7-10-24-8-5-15(6-9-24)19(27)23-20-21-14(2)12-30-20/h3-4,11-12,15H,5-10H2,1-2H3,(H,22,26)(H,21,23,27) |
| InChIKey | QWGLLSYSLNINLG-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 117.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.52 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|