C16H22ClN3O5 — CID 119907912
1-[3-(2-methyl-5-nitroanilino)-3-oxopropyl]piperidine-4-carboxylic acid;hydrochloride (PubChem CID 119907912) has the molecular formula C16H22ClN3O5 and a molecular weight of 371.82 g/mol. Its IUPAC name is 1-[3-(2-methyl-5-nitroanilino)-3-oxopropyl]piperidine-4-carboxylic acid;hydrochloride.
| Compound Name | 1-[3-(2-methyl-5-nitroanilino)-3-oxopropyl]piperidine-4-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 119907912 |
| Molecular Formula | C16H22ClN3O5 |
| Molecular Weight | 371.82 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | 1-[3-(2-methyl-5-nitroanilino)-3-oxopropyl]piperidine-4-carboxylic acid;hydrochloride |
| SMILES | Cc1ccc([N+](=O)[O-])cc1NC(=O)CCN1CCC(C(=O)O)CC1.Cl |
| InChI | InChI=1S/C16H21N3O5.ClH/c1-11-2-3-13(19(23)24)10-14(11)17-15(20)6-9-18-7-4-12(5-8-18)16(21)22;/h2-3,10,12H,4-9H2,1H3,(H,17,20)(H,21,22);1H |
| InChIKey | NGTBGLSOSLAMNF-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 112.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.82 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|