C22H24N4O6 — CID 4927083
1-N,4-N-bis(2-methyl-5-nitrophenyl)cyclohexane-1,4-dicarboxamide (PubChem CID 4927083) has the molecular formula C22H24N4O6 and a molecular weight of 440.46 g/mol. Its IUPAC name is 1-N,4-N-bis(2-methyl-5-nitrophenyl)cyclohexane-1,4-dicarboxamide.
| Compound Name | 1-N,4-N-bis(2-methyl-5-nitrophenyl)cyclohexane-1,4-dicarboxamide |
|---|---|
| PubChem CID | 4927083 |
| Molecular Formula | C22H24N4O6 |
| Molecular Weight | 440.46 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | 1-N,4-N-bis(2-methyl-5-nitrophenyl)cyclohexane-1,4-dicarboxamide |
| SMILES | Cc1ccc([N+](=O)[O-])cc1NC(=O)C1CCC(C(=O)Nc2cc([N+](=O)[O-])ccc2C)CC1 |
| InChI | InChI=1S/C22H24N4O6/c1-13-3-9-17(25(29)30)11-19(13)23-21(27)15-5-7-16(8-6-15)22(28)24-20-12-18(26(31)32)10-4-14(20)2/h3-4,9-12,15-16H,5-8H2,1-2H3,(H,23,27)(H,24,28) |
| InChIKey | XUNDIMUIFBPZNK-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 144.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.46 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|