C14H17N3O4 — CID 18588885
N-cyclopentyl-N'-(2-methyl-5-nitrophenyl)oxamide (PubChem CID 18588885) has the molecular formula C14H17N3O4 and a molecular weight of 291.31 g/mol. Its IUPAC name is N-cyclopentyl-N'-(2-methyl-5-nitrophenyl)oxamide.
| Compound Name | N-cyclopentyl-N'-(2-methyl-5-nitrophenyl)oxamide |
|---|---|
| PubChem CID | 18588885 |
| Molecular Formula | C14H17N3O4 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | N-cyclopentyl-N'-(2-methyl-5-nitrophenyl)oxamide |
| SMILES | Cc1ccc([N+](=O)[O-])cc1NC(=O)C(=O)NC1CCCC1 |
| InChI | InChI=1S/C14H17N3O4/c1-9-6-7-11(17(20)21)8-12(9)16-14(19)13(18)15-10-4-2-3-5-10/h6-8,10H,2-5H2,1H3,(H,15,18)(H,16,19) |
| InChIKey | SCPWHLIDLSDUBM-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|