C20H18N4O6 — CID 2327600
trans-(1R,2R)-3-methylidene-1-N,2-N-bis(2-methyl-5-nitrophenyl)cyclopropane-1,2-dicarboxamide (PubChem CID 2327600) has the molecular formula C20H18N4O6 and a molecular weight of 410.39 g/mol. Its IUPAC name is trans-(1R,2R)-3-methylidene-1-N,2-N-bis(2-methyl-5-nitrophenyl)cyclopropane-1,2-dicarboxamide.
| Compound Name | trans-(1R,2R)-3-methylidene-1-N,2-N-bis(2-methyl-5-nitrophenyl)cyclopropane-1,2-dicarboxamide |
|---|---|
| PubChem CID | 2327600 |
| Molecular Formula | C20H18N4O6 |
| Molecular Weight | 410.39 g/mol |
| Exact Mass | 410.12 |
| IUPAC Name | trans-(1R,2R)-3-methylidene-1-N,2-N-bis(2-methyl-5-nitrophenyl)cyclopropane-1,2-dicarboxamide |
| SMILES | C=C1[C@H](C(=O)Nc2cc([N+](=O)[O-])ccc2C)[C@H]1C(=O)Nc1cc([N+](=O)[O-])ccc1C |
| InChI | InChI=1S/C20H18N4O6/c1-10-4-6-13(23(27)28)8-15(10)21-19(25)17-12(3)18(17)20(26)22-16-9-14(24(29)30)7-5-11(16)2/h4-9,17-18H,3H2,1-2H3,(H,21,25)(H,22,26)/t17-,18-/m0/s1 |
| InChIKey | NRMLPJXDEJBKJE-ROUUACIJSA-N |
| XLogP | 3.50 |
| TPSA | 144.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.39 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|