C20H21N3O4S — CID 19630854
N-[4-[1-(2-methyl-5-nitroanilino)-1-oxopropan-2-yl]sulfanylphenyl]cyclopropanecarboxamide (PubChem CID 19630854) has the molecular formula C20H21N3O4S and a molecular weight of 399.47 g/mol. Its IUPAC name is N-[4-[1-(2-methyl-5-nitroanilino)-1-oxopropan-2-yl]sulfanylphenyl]cyclopropanecarboxamide.
| Compound Name | N-[4-[1-(2-methyl-5-nitroanilino)-1-oxopropan-2-yl]sulfanylphenyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 19630854 |
| Molecular Formula | C20H21N3O4S |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | N-[4-[1-(2-methyl-5-nitroanilino)-1-oxopropan-2-yl]sulfanylphenyl]cyclopropanecarboxamide |
| SMILES | Cc1ccc([N+](=O)[O-])cc1NC(=O)C(C)Sc1ccc(NC(=O)C2CC2)cc1 |
| InChI | InChI=1S/C20H21N3O4S/c1-12-3-8-16(23(26)27)11-18(12)22-19(24)13(2)28-17-9-6-15(7-10-17)21-20(25)14-4-5-14/h3,6-11,13-14H,4-5H2,1-2H3,(H,21,25)(H,22,24) |
| InChIKey | NGVRBVYUZWBCBV-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|