C15H20ClN3O5 — CID 119909354
1-[3-(2-methyl-5-nitroanilino)-3-oxopropyl]pyrrolidine-2-carboxylic acid;hydrochloride (PubChem CID 119909354) has the molecular formula C15H20ClN3O5 and a molecular weight of 357.79 g/mol. Its IUPAC name is 1-[3-(2-methyl-5-nitroanilino)-3-oxopropyl]pyrrolidine-2-carboxylic acid;hydrochloride.
| Compound Name | 1-[3-(2-methyl-5-nitroanilino)-3-oxopropyl]pyrrolidine-2-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 119909354 |
| Molecular Formula | C15H20ClN3O5 |
| Molecular Weight | 357.79 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | 1-[3-(2-methyl-5-nitroanilino)-3-oxopropyl]pyrrolidine-2-carboxylic acid;hydrochloride |
| SMILES | Cc1ccc([N+](=O)[O-])cc1NC(=O)CCN1CCCC1C(=O)O.Cl |
| InChI | InChI=1S/C15H19N3O5.ClH/c1-10-4-5-11(18(22)23)9-12(10)16-14(19)6-8-17-7-2-3-13(17)15(20)21;/h4-5,9,13H,2-3,6-8H2,1H3,(H,16,19)(H,20,21);1H |
| InChIKey | CURXRYZKDPYGHT-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 112.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.79 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|