C22H26N4O5 — CID 37177131
N-(2-methoxyphenyl)-1-[2-(2-methyl-5-nitroanilino)-2-oxoethyl]piperidine-4-carboxamide (PubChem CID 37177131) has the molecular formula C22H26N4O5 and a molecular weight of 426.47 g/mol. Its IUPAC name is N-(2-methoxyphenyl)-1-[2-(2-methyl-5-nitroanilino)-2-oxoethyl]piperidine-4-carboxamide.
| Compound Name | N-(2-methoxyphenyl)-1-[2-(2-methyl-5-nitroanilino)-2-oxoethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 37177131 |
| Molecular Formula | C22H26N4O5 |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.19 |
| IUPAC Name | N-(2-methoxyphenyl)-1-[2-(2-methyl-5-nitroanilino)-2-oxoethyl]piperidine-4-carboxamide |
| SMILES | COc1ccccc1NC(=O)C1CCN(CC(=O)Nc2cc([N+](=O)[O-])ccc2C)CC1 |
| InChI | InChI=1S/C22H26N4O5/c1-15-7-8-17(26(29)30)13-19(15)23-21(27)14-25-11-9-16(10-12-25)22(28)24-18-5-3-4-6-20(18)31-2/h3-8,13,16H,9-12,14H2,1-2H3,(H,23,27)(H,24,28) |
| InChIKey | KEIAJEZHFKQMGF-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 113.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|