C21H24IN3O3 — CID 55680524
1-[2-(4-iodoanilino)-2-oxoethyl]-N-(2-methoxyphenyl)piperidine-4-carboxamide (PubChem CID 55680524) has the molecular formula C21H24IN3O3 and a molecular weight of 493.35 g/mol. Its IUPAC name is 1-[2-(4-iodoanilino)-2-oxoethyl]-N-(2-methoxyphenyl)piperidine-4-carboxamide.
| Compound Name | 1-[2-(4-iodoanilino)-2-oxoethyl]-N-(2-methoxyphenyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55680524 |
| Molecular Formula | C21H24IN3O3 |
| Molecular Weight | 493.35 g/mol |
| Exact Mass | 493.09 |
| IUPAC Name | 1-[2-(4-iodoanilino)-2-oxoethyl]-N-(2-methoxyphenyl)piperidine-4-carboxamide |
| SMILES | COc1ccccc1NC(=O)C1CCN(CC(=O)Nc2ccc(I)cc2)CC1 |
| InChI | InChI=1S/C21H24IN3O3/c1-28-19-5-3-2-4-18(19)24-21(27)15-10-12-25(13-11-15)14-20(26)23-17-8-6-16(22)7-9-17/h2-9,15H,10-14H2,1H3,(H,23,26)(H,24,27) |
| InChIKey | AVGDPKOUYDITJT-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.35 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|