C18H24N4O6 — CID 119662071
4-[2-[4-(3-aminopropoxy)piperidin-1-yl]-2-oxoethyl]-6-nitro-1,4-benzoxazin-3-one (PubChem CID 119662071) has the molecular formula C18H24N4O6 and a molecular weight of 392.41 g/mol. Its IUPAC name is 4-[2-[4-(3-aminopropoxy)piperidin-1-yl]-2-oxoethyl]-6-nitro-1,4-benzoxazin-3-one.
| Compound Name | 4-[2-[4-(3-aminopropoxy)piperidin-1-yl]-2-oxoethyl]-6-nitro-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 119662071 |
| Molecular Formula | C18H24N4O6 |
| Molecular Weight | 392.41 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | 4-[2-[4-(3-aminopropoxy)piperidin-1-yl]-2-oxoethyl]-6-nitro-1,4-benzoxazin-3-one |
| SMILES | NCCCOC1CCN(C(=O)CN2C(=O)COc3ccc([N+](=O)[O-])cc32)CC1 |
| InChI | InChI=1S/C18H24N4O6/c19-6-1-9-27-14-4-7-20(8-5-14)17(23)11-21-15-10-13(22(25)26)2-3-16(15)28-12-18(21)24/h2-3,10,14H,1,4-9,11-12,19H2 |
| InChIKey | YQIAWKDJTAPSRV-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 128.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.41 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|