C16H24ClN3O5 — CID 119664488
[4-(3-aminopropoxy)piperidin-1-yl]-(2-methoxy-5-nitrophenyl)methanone;hydrochloride (PubChem CID 119664488) has the molecular formula C16H24ClN3O5 and a molecular weight of 373.84 g/mol. Its IUPAC name is [4-(3-aminopropoxy)piperidin-1-yl]-(2-methoxy-5-nitrophenyl)methanone;hydrochloride.
| Compound Name | [4-(3-aminopropoxy)piperidin-1-yl]-(2-methoxy-5-nitrophenyl)methanone;hydrochloride |
|---|---|
| PubChem CID | 119664488 |
| Molecular Formula | C16H24ClN3O5 |
| Molecular Weight | 373.84 g/mol |
| Exact Mass | 373.14 |
| IUPAC Name | [4-(3-aminopropoxy)piperidin-1-yl]-(2-methoxy-5-nitrophenyl)methanone;hydrochloride |
| SMILES | COc1ccc([N+](=O)[O-])cc1C(=O)N1CCC(OCCCN)CC1.Cl |
| InChI | InChI=1S/C16H23N3O5.ClH/c1-23-15-4-3-12(19(21)22)11-14(15)16(20)18-8-5-13(6-9-18)24-10-2-7-17;/h3-4,11,13H,2,5-10,17H2,1H3;1H |
| InChIKey | CPLZKFDFWAQSIH-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 107.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.84 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|