C17H24ClN3O4 — CID 119625194
[4-(cyclopropylmethylamino)piperidin-1-yl]-(2-methoxy-5-nitrophenyl)methanone;hydrochloride (PubChem CID 119625194) has the molecular formula C17H24ClN3O4 and a molecular weight of 369.85 g/mol. Its IUPAC name is [4-(cyclopropylmethylamino)piperidin-1-yl]-(2-methoxy-5-nitrophenyl)methanone;hydrochloride.
| Compound Name | [4-(cyclopropylmethylamino)piperidin-1-yl]-(2-methoxy-5-nitrophenyl)methanone;hydrochloride |
|---|---|
| PubChem CID | 119625194 |
| Molecular Formula | C17H24ClN3O4 |
| Molecular Weight | 369.85 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | [4-(cyclopropylmethylamino)piperidin-1-yl]-(2-methoxy-5-nitrophenyl)methanone;hydrochloride |
| SMILES | COc1ccc([N+](=O)[O-])cc1C(=O)N1CCC(NCC2CC2)CC1.Cl |
| InChI | InChI=1S/C17H23N3O4.ClH/c1-24-16-5-4-14(20(22)23)10-15(16)17(21)19-8-6-13(7-9-19)18-11-12-2-3-12;/h4-5,10,12-13,18H,2-3,6-9,11H2,1H3;1H |
| InChIKey | CNWGNNQHVULRFP-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.85 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|