C20H29N3O4 — CID 55955454
[4-(cyclohexylmethyl)-1,4-diazepan-1-yl]-(2-methoxy-5-nitrophenyl)methanone (PubChem CID 55955454) has the molecular formula C20H29N3O4 and a molecular weight of 375.47 g/mol. Its IUPAC name is [4-(cyclohexylmethyl)-1,4-diazepan-1-yl]-(2-methoxy-5-nitrophenyl)methanone.
| Compound Name | [4-(cyclohexylmethyl)-1,4-diazepan-1-yl]-(2-methoxy-5-nitrophenyl)methanone |
|---|---|
| PubChem CID | 55955454 |
| Molecular Formula | C20H29N3O4 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.22 |
| IUPAC Name | [4-(cyclohexylmethyl)-1,4-diazepan-1-yl]-(2-methoxy-5-nitrophenyl)methanone |
| SMILES | COc1ccc([N+](=O)[O-])cc1C(=O)N1CCCN(CC2CCCCC2)CC1 |
| InChI | InChI=1S/C20H29N3O4/c1-27-19-9-8-17(23(25)26)14-18(19)20(24)22-11-5-10-21(12-13-22)15-16-6-3-2-4-7-16/h8-9,14,16H,2-7,10-13,15H2,1H3 |
| InChIKey | WVXTYHOZJQIVLM-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 75.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|