C18H23N3O7 — CID 120606367
2-[acetyl-[1-(2-methoxy-5-nitrobenzoyl)azepan-4-yl]amino]acetic acid (PubChem CID 120606367) has the molecular formula C18H23N3O7 and a molecular weight of 393.40 g/mol. Its IUPAC name is 2-[acetyl-[1-(2-methoxy-5-nitrobenzoyl)azepan-4-yl]amino]acetic acid.
| Compound Name | 2-[acetyl-[1-(2-methoxy-5-nitrobenzoyl)azepan-4-yl]amino]acetic acid |
|---|---|
| PubChem CID | 120606367 |
| Molecular Formula | C18H23N3O7 |
| Molecular Weight | 393.40 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | 2-[acetyl-[1-(2-methoxy-5-nitrobenzoyl)azepan-4-yl]amino]acetic acid |
| SMILES | COc1ccc([N+](=O)[O-])cc1C(=O)N1CCCC(N(CC(=O)O)C(C)=O)CC1 |
| InChI | InChI=1S/C18H23N3O7/c1-12(22)20(11-17(23)24)13-4-3-8-19(9-7-13)18(25)15-10-14(21(26)27)5-6-16(15)28-2/h5-6,10,13H,3-4,7-9,11H2,1-2H3,(H,23,24) |
| InChIKey | XAGAYQOLCFDMIQ-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 130.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.40 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|